C6H12N2O5S — CID 175492815
1,4-diaminocyclohexa-2,4-dien-1-ol;sulfuric acid (PubChem CID 175492815) has the molecular formula C6H12N2O5S and a molecular weight of 224.24 g/mol. Its IUPAC name is 1,4-diaminocyclohexa-2,4-dien-1-ol;sulfuric acid.
| Compound Name | 1,4-diaminocyclohexa-2,4-dien-1-ol;sulfuric acid |
|---|---|
| PubChem CID | 175492815 |
| Molecular Formula | C6H12N2O5S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1,4-diaminocyclohexa-2,4-dien-1-ol;sulfuric acid |
| SMILES | NC1=CCC(N)(O)C=C1.O=S(=O)(O)O |
| InChI | InChI=1S/C6H10N2O.H2O4S/c7-5-1-3-6(8,9)4-2-5;1-5(2,3)4/h1-3,9H,4,7-8H2;(H2,1,2,3,4) |
| InChIKey | XPVNLHQXYPYLCZ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|