C9H9NO2 — CID 175493199
1-(cyclopenten-1-yl)pyrrole-2,5-dione (PubChem CID 175493199) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-(cyclopenten-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(cyclopenten-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175493199 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 1-(cyclopenten-1-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C1=CCCC1 |
| InChI | InChI=1S/C9H9NO2/c11-8-5-6-9(12)10(8)7-3-1-2-4-7/h3,5-6H,1-2,4H2 |
| InChIKey | NQFQNYCYEVDARF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|