C6H10N2O3 — CID 175495601
(3aS)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylic acid (PubChem CID 175495601) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is (3aS)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylic acid.
| Compound Name | (3aS)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 175495601 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (3aS)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylic acid |
| SMILES | O=C(O)N1CC2ONC[C@@H]2C1 |
| InChI | InChI=1S/C6H10N2O3/c9-6(10)8-2-4-1-7-11-5(4)3-8/h4-5,7H,1-3H2,(H,9,10)/t4-,5?/m1/s1 |
| InChIKey | CSURJIAPBRULCN-CNZKWPKMSA-N |
| XLogP | -0.50 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |