About hex-2-ynyl hexaneperoxoate
hex-2-ynyl hexaneperoxoate (PubChem CID 175496531) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is hex-2-ynyl hexaneperoxoate.
Molecular Properties
| Compound Name | hex-2-ynyl hexaneperoxoate |
| PubChem CID | 175496531 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | hex-2-ynyl hexaneperoxoate |
| SMILES | CCCC#CCOOC(=O)CCCCC |
| InChI | InChI=1S/C12H20O3/c1-3-5-7-9-11-14-15-12(13)10-8-6-4-2/h3-6,8,10-11H2,1-2H3 |
| InChIKey | RIHXCLIJAQERAY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-2-ynyl hexaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-2-ynyl hexaneperoxoate?
The IUPAC name of hex-2-ynyl hexaneperoxoate (CID 175496531) is hex-2-ynyl hexaneperoxoate.
What is the SMILES notation for hex-2-ynyl hexaneperoxoate?
The canonical SMILES for hex-2-ynyl hexaneperoxoate is CCCC#CCOOC(=O)CCCCC.
What is the InChIKey of hex-2-ynyl hexaneperoxoate?
The InChIKey is RIHXCLIJAQERAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-3-5-7-9-11-14-15-12(13)10-8-6-4-2/h3-6,8,10-11H2,1-2H3.
What are the key properties of hex-2-ynyl hexaneperoxoate?
hex-2-ynyl hexaneperoxoate has a molecular weight of 212.29 g/mol, XLogP of 2.85, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hex-2-ynyl hexaneperoxoate is sourced from PubChem (CID 175496531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).