C21H12BrF2N3O4S2 — CID 175498821
[4-[5-[(2,6-difluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl] 2-bromobenzenesulfonate (PubChem CID 175498821) has the molecular formula C21H12BrF2N3O4S2 and a molecular weight of 552.38 g/mol. Its IUPAC name is [4-[5-[(2,6-difluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl] 2-bromobenzenesulfonate.
| Compound Name | [4-[5-[(2,6-difluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl] 2-bromobenzenesulfonate |
|---|---|
| PubChem CID | 175498821 |
| Molecular Formula | C21H12BrF2N3O4S2 |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 550.94 |
| IUPAC Name | [4-[5-[(2,6-difluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl] 2-bromobenzenesulfonate |
| SMILES | O=C(Nc1nnc(-c2ccc(OS(=O)(=O)c3ccccc3Br)cc2)s1)c1c(F)cccc1F |
| InChI | InChI=1S/C21H12BrF2N3O4S2/c22-14-4-1-2-7-17(14)33(29,30)31-13-10-8-12(9-11-13)20-26-27-21(32-20)25-19(28)18-15(23)5-3-6-16(18)24/h1-11H,(H,25,27,28) |
| InChIKey | UUMXIQGHAGIWDX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|