C8H20O6Si — CID 175499043
2-(1,2,2,2-tetramethoxyethoxy)ethoxysilane (PubChem CID 175499043) has the molecular formula C8H20O6Si and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-(1,2,2,2-tetramethoxyethoxy)ethoxysilane.
| Compound Name | 2-(1,2,2,2-tetramethoxyethoxy)ethoxysilane |
|---|---|
| PubChem CID | 175499043 |
| Molecular Formula | C8H20O6Si |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(1,2,2,2-tetramethoxyethoxy)ethoxysilane |
| SMILES | COC(OCCO[SiH3])C(OC)(OC)OC |
| InChI | InChI=1S/C8H20O6Si/c1-9-7(13-5-6-14-15)8(10-2,11-3)12-4/h7H,5-6H2,1-4,15H3 |
| InChIKey | MWRZQUNUARVUKV-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|