C5H16O3Si2 — CID 173051795
(1,2,2-trimethoxy-1-silylethyl)silane (PubChem CID 173051795) has the molecular formula C5H16O3Si2 and a molecular weight of 180.35 g/mol. Its IUPAC name is (1,2,2-trimethoxy-1-silylethyl)silane.
| Compound Name | (1,2,2-trimethoxy-1-silylethyl)silane |
|---|---|
| PubChem CID | 173051795 |
| Molecular Formula | C5H16O3Si2 |
| Molecular Weight | 180.35 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (1,2,2-trimethoxy-1-silylethyl)silane |
| SMILES | COC(OC)C([SiH3])([SiH3])OC |
| InChI | InChI=1S/C5H16O3Si2/c1-6-4(7-2)5(9,10)8-3/h4H,1-3,9-10H3 |
| InChIKey | LYKQMESOOYYPNX-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.35 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|