C12H31NO6Si2 — CID 172996453
1,3,3-trimethoxy-3-silyl-N-(1,3,3-trimethoxy-3-silylpropyl)propan-1-amine (PubChem CID 172996453) has the molecular formula C12H31NO6Si2 and a molecular weight of 341.55 g/mol. Its IUPAC name is 1,3,3-trimethoxy-3-silyl-N-(1,3,3-trimethoxy-3-silylpropyl)propan-1-amine.
| Compound Name | 1,3,3-trimethoxy-3-silyl-N-(1,3,3-trimethoxy-3-silylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 172996453 |
| Molecular Formula | C12H31NO6Si2 |
| Molecular Weight | 341.55 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1,3,3-trimethoxy-3-silyl-N-(1,3,3-trimethoxy-3-silylpropyl)propan-1-amine |
| SMILES | COC(CC([SiH3])(OC)OC)NC(CC([SiH3])(OC)OC)OC |
| InChI | InChI=1S/C12H31NO6Si2/c1-14-9(7-11(20,16-3)17-4)13-10(15-2)8-12(21,18-5)19-6/h9-10,13H,7-8H2,1-6,20-21H3 |
| InChIKey | OEVIQBDWGBUUBL-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.55 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|