C7H15NO4Si — CID 160733039
(3-isocyanato-1,1,3-trimethoxypropyl)silane (PubChem CID 160733039) has the molecular formula C7H15NO4Si and a molecular weight of 205.29 g/mol. Its IUPAC name is (3-isocyanato-1,1,3-trimethoxypropyl)silane.
| Compound Name | (3-isocyanato-1,1,3-trimethoxypropyl)silane |
|---|---|
| PubChem CID | 160733039 |
| Molecular Formula | C7H15NO4Si |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | (3-isocyanato-1,1,3-trimethoxypropyl)silane |
| SMILES | COC(CC([SiH3])(OC)OC)N=C=O |
| InChI | InChI=1S/C7H15NO4Si/c1-10-6(8-5-9)4-7(13,11-2)12-3/h6H,4H2,1-3,13H3 |
| InChIKey | RUPAEOZDYGXAJR-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|