C10H21NO4Si — CID 173052095
(2-isocyanato-4,4-dimethylpentoxy)-dimethoxysilane (PubChem CID 173052095) has the molecular formula C10H21NO4Si and a molecular weight of 247.37 g/mol. Its IUPAC name is (2-isocyanato-4,4-dimethylpentoxy)-dimethoxysilane.
| Compound Name | (2-isocyanato-4,4-dimethylpentoxy)-dimethoxysilane |
|---|---|
| PubChem CID | 173052095 |
| Molecular Formula | C10H21NO4Si |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (2-isocyanato-4,4-dimethylpentoxy)-dimethoxysilane |
| SMILES | CO[SiH](OC)OCC(CC(C)(C)C)N=C=O |
| InChI | InChI=1S/C10H21NO4Si/c1-10(2,3)6-9(11-8-12)7-15-16(13-4)14-5/h9,16H,6-7H2,1-5H3 |
| InChIKey | QAGYAEVPQISWIO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|