C11H21NO2 — CID 58818488
(2S)-2-isocyanato-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxy]butane (PubChem CID 58818488) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (2S)-2-isocyanato-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxy]butane.
| Compound Name | (2S)-2-isocyanato-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxy]butane |
|---|---|
| PubChem CID | 58818488 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2S)-2-isocyanato-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxy]butane |
| SMILES | CC(C)(C)OC[C@@H](N=C=O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-10(2,3)9(12-8-13)7-14-11(4,5)6/h9H,7H2,1-6H3/t9-/m1/s1 |
| InChIKey | BGOFVHNBUWNOSH-SECBINFHSA-N |
| XLogP | 2.55 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|