C8H6N4O5 — CID 57304051
2-(2,2-diisocyanatoethoxy)-1,1-diisocyanatoethane (PubChem CID 57304051) has the molecular formula C8H6N4O5 and a molecular weight of 238.16 g/mol. Its IUPAC name is 2-(2,2-diisocyanatoethoxy)-1,1-diisocyanatoethane.
| Compound Name | 2-(2,2-diisocyanatoethoxy)-1,1-diisocyanatoethane |
|---|---|
| PubChem CID | 57304051 |
| Molecular Formula | C8H6N4O5 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-(2,2-diisocyanatoethoxy)-1,1-diisocyanatoethane |
| SMILES | O=C=NC(COCC(N=C=O)N=C=O)N=C=O |
| InChI | InChI=1S/C8H6N4O5/c13-3-9-7(10-4-14)1-17-2-8(11-5-15)12-6-16/h7-8H,1-2H2 |
| InChIKey | RHQOFKSCPMBXKU-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 126.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|