C6H13F3O2Si — CID 173091582
(3,4,4-trifluoro-1,1-dimethoxybutyl)silane (PubChem CID 173091582) has the molecular formula C6H13F3O2Si and a molecular weight of 202.25 g/mol. Its IUPAC name is (3,4,4-trifluoro-1,1-dimethoxybutyl)silane.
| Compound Name | (3,4,4-trifluoro-1,1-dimethoxybutyl)silane |
|---|---|
| PubChem CID | 173091582 |
| Molecular Formula | C6H13F3O2Si |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (3,4,4-trifluoro-1,1-dimethoxybutyl)silane |
| SMILES | COC([SiH3])(CC(F)C(F)F)OC |
| InChI | InChI=1S/C6H13F3O2Si/c1-10-6(12,11-2)3-4(7)5(8)9/h4-5H,3H2,1-2,12H3 |
| InChIKey | JMVCEYMMLHLGGL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|