C13H12ClN3O4S — CID 175499222
5-[[3-(chloromethoxy)phenyl]sulfonylamino]pyridine-3-carboxamide (PubChem CID 175499222) has the molecular formula C13H12ClN3O4S and a molecular weight of 341.78 g/mol. Its IUPAC name is 5-[[3-(chloromethoxy)phenyl]sulfonylamino]pyridine-3-carboxamide.
| Compound Name | 5-[[3-(chloromethoxy)phenyl]sulfonylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175499222 |
| Molecular Formula | C13H12ClN3O4S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 5-[[3-(chloromethoxy)phenyl]sulfonylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(NS(=O)(=O)c2cccc(OCCl)c2)c1 |
| InChI | InChI=1S/C13H12ClN3O4S/c14-8-21-11-2-1-3-12(5-11)22(19,20)17-10-4-9(13(15)18)6-16-7-10/h1-7,17H,8H2,(H2,15,18) |
| InChIKey | ACBFZVVVKXINMA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|