C11H11FN2O2S2 — CID 175500524
5-[1-(3-fluorophenoxy)ethylsulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 175500524) has the molecular formula C11H11FN2O2S2 and a molecular weight of 286.35 g/mol. Its IUPAC name is 5-[1-(3-fluorophenoxy)ethylsulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[1-(3-fluorophenoxy)ethylsulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 175500524 |
| Molecular Formula | C11H11FN2O2S2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 5-[1-(3-fluorophenoxy)ethylsulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CC(Oc1cccc(F)c1)SCc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C11H11FN2O2S2/c1-7(15-9-4-2-3-8(12)5-9)18-6-10-13-14-11(17)16-10/h2-5,7H,6H2,1H3,(H,14,17) |
| InChIKey | UAMOHHUTUPTDGX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|