About nickel;oxido-oxo-sulfophosphanium
nickel;oxido-oxo-sulfophosphanium (PubChem CID 175500737) has the molecular formula HNiO5PS
and a molecular weight of 202.74 g/mol. Its IUPAC name is nickel;oxido-oxo-sulfophosphanium.
Molecular Properties
| Compound Name | nickel;oxido-oxo-sulfophosphanium |
| PubChem CID | 175500737 |
| Molecular Formula | HNiO5PS |
| Molecular Weight | 202.74 g/mol |
| Exact Mass | 201.86 |
| IUPAC Name | nickel;oxido-oxo-sulfophosphanium |
| SMILES | O=[P+]([O-])S(=O)(=O)O.[Ni] |
| InChI | InChI=1S/Ni.HO5PS/c;1-6(2)7(3,4)5/h;(H,3,4,5) |
| InChIKey | BNNCSWYRMOLGQA-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.74 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze nickel;oxido-oxo-sulfophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;oxido-oxo-sulfophosphanium?
The IUPAC name of nickel;oxido-oxo-sulfophosphanium (CID 175500737) is nickel;oxido-oxo-sulfophosphanium.
What is the SMILES notation for nickel;oxido-oxo-sulfophosphanium?
The canonical SMILES for nickel;oxido-oxo-sulfophosphanium is O=[P+]([O-])S(=O)(=O)O.[Ni].
What is the InChIKey of nickel;oxido-oxo-sulfophosphanium?
The InChIKey is BNNCSWYRMOLGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/Ni.HO5PS/c;1-6(2)7(3,4)5/h;(H,3,4,5).
What are the key properties of nickel;oxido-oxo-sulfophosphanium?
nickel;oxido-oxo-sulfophosphanium has a molecular weight of 202.74 g/mol, XLogP of -1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;oxido-oxo-sulfophosphanium is sourced from PubChem (CID 175500737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).