C16H24ClNO3S — CID 175502192
1-(2-chloroethyl)-2,2-dimethyl-4-[(4-methylsulfonylphenoxy)methyl]pyrrolidine (PubChem CID 175502192) has the molecular formula C16H24ClNO3S and a molecular weight of 345.89 g/mol. Its IUPAC name is 1-(2-chloroethyl)-2,2-dimethyl-4-[(4-methylsulfonylphenoxy)methyl]pyrrolidine.
| Compound Name | 1-(2-chloroethyl)-2,2-dimethyl-4-[(4-methylsulfonylphenoxy)methyl]pyrrolidine |
|---|---|
| PubChem CID | 175502192 |
| Molecular Formula | C16H24ClNO3S |
| Molecular Weight | 345.89 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-(2-chloroethyl)-2,2-dimethyl-4-[(4-methylsulfonylphenoxy)methyl]pyrrolidine |
| SMILES | CC1(C)CC(COc2ccc(S(C)(=O)=O)cc2)CN1CCCl |
| InChI | InChI=1S/C16H24ClNO3S/c1-16(2)10-13(11-18(16)9-8-17)12-21-14-4-6-15(7-5-14)22(3,19)20/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | VUOMOMDAHYCNQM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|