C12H13FN2O2S — CID 175502426
4-[2-(3-fluorophenoxy)ethylsulfanylmethyl]-1,3-dihydroimidazol-2-one (PubChem CID 175502426) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-[2-(3-fluorophenoxy)ethylsulfanylmethyl]-1,3-dihydroimidazol-2-one.
| Compound Name | 4-[2-(3-fluorophenoxy)ethylsulfanylmethyl]-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 175502426 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-[2-(3-fluorophenoxy)ethylsulfanylmethyl]-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(CSCCOc2cccc(F)c2)[nH]1 |
| InChI | InChI=1S/C12H13FN2O2S/c13-9-2-1-3-11(6-9)17-4-5-18-8-10-7-14-12(16)15-10/h1-3,6-7H,4-5,8H2,(H2,14,15,16) |
| InChIKey | BFECPTBJEPPTGF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|