C27H43N5O5 — CID 175504660
2-[[3-(aminomethyl)oxetan-3-yl]amino]-N'-(2,2-dimethylpropyl)-N-[3-methoxy-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl]butanediamide (PubChem CID 175504660) has the molecular formula C27H43N5O5 and a molecular weight of 517.67 g/mol. Its IUPAC name is 2-[[3-(aminomethyl)oxetan-3-yl]amino]-N'-(2,2-dimethylpropyl)-N-[3-methoxy-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl]butanediamide.
| Compound Name | 2-[[3-(aminomethyl)oxetan-3-yl]amino]-N'-(2,2-dimethylpropyl)-N-[3-methoxy-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl]butanediamide |
|---|---|
| PubChem CID | 175504660 |
| Molecular Formula | C27H43N5O5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | 2-[[3-(aminomethyl)oxetan-3-yl]amino]-N'-(2,2-dimethylpropyl)-N-[3-methoxy-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl]butanediamide |
| SMILES | COCC(NC(=O)C(CC(=O)NCC(C)(C)C)NC1(CN)COC1)C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C27H43N5O5/c1-26(2,3)15-29-23(33)12-21(32-27(14-28)16-37-17-27)24(34)31-22(13-36-4)25(35)30-20-11-7-9-18-8-5-6-10-19(18)20/h5-6,8,10,20-22,32H,7,9,11-17,28H2,1-4H3,(H,29,33)(H,30,35)(H,31,34)/t20-,21?,22?/m1/s1 |
| InChIKey | QLGSWFHALOZVCK-ITAUSPCMSA-N |
| XLogP | 0.55 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |