C34H33Br2N9O4 — CID 175505311
tert-butyl 3,4-bis[[4-(8-bromo-7-hydroxyquinoxalin-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 175505311) has the molecular formula C34H33Br2N9O4 and a molecular weight of 791.50 g/mol. Its IUPAC name is tert-butyl 3,4-bis[[4-(8-bromo-7-hydroxyquinoxalin-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3,4-bis[[4-(8-bromo-7-hydroxyquinoxalin-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175505311 |
| Molecular Formula | C34H33Br2N9O4 |
| Molecular Weight | 791.50 g/mol |
| Exact Mass | 789.10 |
| IUPAC Name | tert-butyl 3,4-bis[[4-(8-bromo-7-hydroxyquinoxalin-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2cc(-c3cnc4ccc(O)c(Br)c4n3)cn2)C(Cn2cc(-c3cnc4ccc(O)c(Br)c4n3)cn2)C1 |
| InChI | InChI=1S/C34H33Br2N9O4/c1-34(2,3)49-33(48)43-9-8-19(15-44-16-20(10-39-44)25-12-37-23-4-6-27(46)29(35)31(23)41-25)22(14-43)18-45-17-21(11-40-45)26-13-38-24-5-7-28(47)30(36)32(24)42-26/h4-7,10-13,16-17,19,22,46-47H,8-9,14-15,18H2,1-3H3 |
| InChIKey | PGURQLAEXYCIPD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |