About ethynyl formate;1-pentyl-4-phenylbenzene
ethynyl formate;1-pentyl-4-phenylbenzene (PubChem CID 175505497) has the molecular formula C20H22O2
and a molecular weight of 294.39 g/mol. Its IUPAC name is ethynyl formate;1-pentyl-4-phenylbenzene.
Molecular Properties
| Compound Name | ethynyl formate;1-pentyl-4-phenylbenzene |
| PubChem CID | 175505497 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | ethynyl formate;1-pentyl-4-phenylbenzene |
| SMILES | C#COC=O.CCCCCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20.C3H2O2/c1-2-3-5-8-15-11-13-17(14-12-15)16-9-6-4-7-10-16;1-2-5-3-4/h4,6-7,9-14H,2-3,5,8H2,1H3;1,3H |
| InChIKey | SHKIKRSMMHNDOP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynyl formate;1-pentyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynyl formate;1-pentyl-4-phenylbenzene?
The IUPAC name of ethynyl formate;1-pentyl-4-phenylbenzene (CID 175505497) is ethynyl formate;1-pentyl-4-phenylbenzene.
What is the SMILES notation for ethynyl formate;1-pentyl-4-phenylbenzene?
The canonical SMILES for ethynyl formate;1-pentyl-4-phenylbenzene is C#COC=O.CCCCCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of ethynyl formate;1-pentyl-4-phenylbenzene?
The InChIKey is SHKIKRSMMHNDOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20.C3H2O2/c1-2-3-5-8-15-11-13-17(14-12-15)16-9-6-4-7-10-16;1-2-5-3-4/h4,6-7,9-14H,2-3,5,8H2,1H3;1,3H.
What are the key properties of ethynyl formate;1-pentyl-4-phenylbenzene?
ethynyl formate;1-pentyl-4-phenylbenzene has a molecular weight of 294.39 g/mol, XLogP of 4.84, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethynyl formate;1-pentyl-4-phenylbenzene is sourced from PubChem (CID 175505497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).