C10H19BO4Zn — CID 175508535
oxozinc;[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxyboronic acid (PubChem CID 175508535) has the molecular formula C10H19BO4Zn and a molecular weight of 279.46 g/mol. Its IUPAC name is oxozinc;[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxyboronic acid.
| Compound Name | oxozinc;[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxyboronic acid |
|---|---|
| PubChem CID | 175508535 |
| Molecular Formula | C10H19BO4Zn |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | oxozinc;[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxyboronic acid |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@@H](OB(O)O)C2.O=[Zn] |
| InChI | InChI=1S/C10H19BO3.O.Zn/c1-9(2)7-4-5-10(9,3)8(6-7)14-11(12)13;;/h7-8,12-13H,4-6H2,1-3H3;;/t7-,8+,10-;;/m1../s1 |
| InChIKey | LZGKGXBMHQQTRI-JKLXKZJQSA-N |
| XLogP | 1.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|