C10H10F3N3O2 — CID 175509109
(3S)-3-[6-(trifluoromethyl)pyridazin-3-yl]morpholine-4-carbaldehyde (PubChem CID 175509109) has the molecular formula C10H10F3N3O2 and a molecular weight of 261.20 g/mol. Its IUPAC name is (3S)-3-[6-(trifluoromethyl)pyridazin-3-yl]morpholine-4-carbaldehyde.
| Compound Name | (3S)-3-[6-(trifluoromethyl)pyridazin-3-yl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 175509109 |
| Molecular Formula | C10H10F3N3O2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (3S)-3-[6-(trifluoromethyl)pyridazin-3-yl]morpholine-4-carbaldehyde |
| SMILES | O=CN1CCOC[C@@H]1c1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C10H10F3N3O2/c11-10(12,13)9-2-1-7(14-15-9)8-5-18-4-3-16(8)6-17/h1-2,6,8H,3-5H2/t8-/m1/s1 |
| InChIKey | DWBQNCHAVFEBFI-MRVPVSSYSA-N |
| XLogP | 1.03 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|