About 8-bromooctanoic acid;3-butylheptanoic acid
8-bromooctanoic acid;3-butylheptanoic acid (PubChem CID 175510905) has the molecular formula C19H37BrO4
and a molecular weight of 409.41 g/mol. Its IUPAC name is 8-bromooctanoic acid;3-butylheptanoic acid.
Molecular Properties
| Compound Name | 8-bromooctanoic acid;3-butylheptanoic acid |
| PubChem CID | 175510905 |
| Molecular Formula | C19H37BrO4 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 8-bromooctanoic acid;3-butylheptanoic acid |
| SMILES | CCCCC(CCCC)CC(=O)O.O=C(O)CCCCCCCBr |
| InChI | InChI=1S/C11H22O2.C8H15BrO2/c1-3-5-7-10(8-6-4-2)9-11(12)13;9-7-5-3-1-2-4-6-8(10)11/h10H,3-9H2,1-2H3,(H,12,13);1-7H2,(H,10,11) |
| InChIKey | GXZVGXOFZLPGGP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-bromooctanoic acid;3-butylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromooctanoic acid;3-butylheptanoic acid?
The IUPAC name of 8-bromooctanoic acid;3-butylheptanoic acid (CID 175510905) is 8-bromooctanoic acid;3-butylheptanoic acid.
What is the SMILES notation for 8-bromooctanoic acid;3-butylheptanoic acid?
The canonical SMILES for 8-bromooctanoic acid;3-butylheptanoic acid is CCCCC(CCCC)CC(=O)O.O=C(O)CCCCCCCBr.
What is the InChIKey of 8-bromooctanoic acid;3-butylheptanoic acid?
The InChIKey is GXZVGXOFZLPGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2.C8H15BrO2/c1-3-5-7-10(8-6-4-2)9-11(12)13;9-7-5-3-1-2-4-6-8(10)11/h10H,3-9H2,1-2H3,(H,12,13);1-7H2,(H,10,11).
What are the key properties of 8-bromooctanoic acid;3-butylheptanoic acid?
8-bromooctanoic acid;3-butylheptanoic acid has a molecular weight of 409.41 g/mol, XLogP of 6.26, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromooctanoic acid;3-butylheptanoic acid is sourced from PubChem (CID 175510905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).