C10H13ClN2O2 — CID 175511090
[5-chloro-2-(ethylamino)phenyl]methyl carbamate (PubChem CID 175511090) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is [5-chloro-2-(ethylamino)phenyl]methyl carbamate.
| Compound Name | [5-chloro-2-(ethylamino)phenyl]methyl carbamate |
|---|---|
| PubChem CID | 175511090 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | [5-chloro-2-(ethylamino)phenyl]methyl carbamate |
| SMILES | CCNc1ccc(Cl)cc1COC(N)=O |
| InChI | InChI=1S/C10H13ClN2O2/c1-2-13-9-4-3-8(11)5-7(9)6-15-10(12)14/h3-5,13H,2,6H2,1H3,(H2,12,14) |
| InChIKey | ZPALCMAILXVRPJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |