C23H21NO6 — CID 175513931
2,3-dimethoxy-1-methyl-9H-carbazole;terephthalic acid (PubChem CID 175513931) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2,3-dimethoxy-1-methyl-9H-carbazole;terephthalic acid.
| Compound Name | 2,3-dimethoxy-1-methyl-9H-carbazole;terephthalic acid |
|---|---|
| PubChem CID | 175513931 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2,3-dimethoxy-1-methyl-9H-carbazole;terephthalic acid |
| SMILES | COc1cc2c([nH]c3ccccc32)c(C)c1OC.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H15NO2.C8H6O4/c1-9-14-11(8-13(17-2)15(9)18-3)10-6-4-5-7-12(10)16-14;9-7(10)5-1-2-6(4-3-5)8(11)12/h4-8,16H,1-3H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | YNLDCBUZXVQJTH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |