C28H40BF3N2O6 — CID 175518097
tert-butyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)-3,4-dihydro-1H-isoquinolin-8-yl]pyrrolidine-1-carboxylate (PubChem CID 175518097) has the molecular formula C28H40BF3N2O6 and a molecular weight of 568.44 g/mol. Its IUPAC name is tert-butyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)-3,4-dihydro-1H-isoquinolin-8-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)-3,4-dihydro-1H-isoquinolin-8-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175518097 |
| Molecular Formula | C28H40BF3N2O6 |
| Molecular Weight | 568.44 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | tert-butyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)-3,4-dihydro-1H-isoquinolin-8-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1cc(B2OC(C)(C)C(C)(C)O2)cc2c1CN(C(=O)C(C)(O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C28H40BF3N2O6/c1-24(2,3)38-23(36)34-12-9-10-21(34)19-15-18(29-39-25(4,5)26(6,7)40-29)14-17-11-13-33(16-20(17)19)22(35)27(8,37)28(30,31)32/h14-15,21,37H,9-13,16H2,1-8H3 |
| InChIKey | OGGOAYQKXOBJPB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|