C28H43BN2O7 — CID 174053574
tert-butyl 3-[2-(2-hydroxy-2-methylpropanoyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-8-yl]morpholine-4-carboxylate (PubChem CID 174053574) has the molecular formula C28H43BN2O7 and a molecular weight of 530.47 g/mol. Its IUPAC name is tert-butyl 3-[2-(2-hydroxy-2-methylpropanoyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-8-yl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(2-hydroxy-2-methylpropanoyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-8-yl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 174053574 |
| Molecular Formula | C28H43BN2O7 |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | tert-butyl 3-[2-(2-hydroxy-2-methylpropanoyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-8-yl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1c1cc(B2OC(C)(C)C(C)(C)O2)cc2c1CN(C(=O)C(C)(C)O)CC2 |
| InChI | InChI=1S/C28H43BN2O7/c1-25(2,3)36-24(33)31-12-13-35-17-22(31)20-15-19(29-37-27(6,7)28(8,9)38-29)14-18-10-11-30(16-21(18)20)23(32)26(4,5)34/h14-15,22,34H,10-13,16-17H2,1-9H3 |
| InChIKey | RDLUTKRRLJFFKY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|