C18H16BrF2NO2 — CID 175519537
2-bromo-2,2-difluoro-N-(4-phenylmethoxyphenyl)-N-prop-2-enylacetamide (PubChem CID 175519537) has the molecular formula C18H16BrF2NO2 and a molecular weight of 396.23 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-N-(4-phenylmethoxyphenyl)-N-prop-2-enylacetamide.
| Compound Name | 2-bromo-2,2-difluoro-N-(4-phenylmethoxyphenyl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 175519537 |
| Molecular Formula | C18H16BrF2NO2 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2-bromo-2,2-difluoro-N-(4-phenylmethoxyphenyl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)C(F)(F)Br)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H16BrF2NO2/c1-2-12-22(17(23)18(19,20)21)15-8-10-16(11-9-15)24-13-14-6-4-3-5-7-14/h2-11H,1,12-13H2 |
| InChIKey | FKVGJDIPHGSRTM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|