C31H35FN8O4 — CID 175522083
4-[6-[[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]amino]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 175522083) has the molecular formula C31H35FN8O4 and a molecular weight of 602.67 g/mol. Its IUPAC name is 4-[6-[[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]amino]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[6-[[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]amino]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175522083 |
| Molecular Formula | C31H35FN8O4 |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 4-[6-[[4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-5-fluoropyrimidin-2-yl]amino]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Cn1ncc(-c2nc(NCCCCCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)ncc2F)c1CC1CC1 |
| InChI | InChI=1S/C31H35FN8O4/c1-39-24(15-18-9-10-18)20(16-36-39)27-21(32)17-35-31(38-27)34-14-5-3-2-4-13-33-22-8-6-7-19-26(22)30(44)40(29(19)43)23-11-12-25(41)37-28(23)42/h6-8,16-18,23,33H,2-5,9-15H2,1H3,(H,34,35,38)(H,37,41,42) |
| InChIKey | RWSYKMCDTFJHKU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 151.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|