C16H13N3O4 — CID 175526384
1-acetyl-3-[(5-phenyl-1,3-oxazol-4-yl)methylidene]piperazine-2,5-dione (PubChem CID 175526384) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 1-acetyl-3-[(5-phenyl-1,3-oxazol-4-yl)methylidene]piperazine-2,5-dione.
| Compound Name | 1-acetyl-3-[(5-phenyl-1,3-oxazol-4-yl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 175526384 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-acetyl-3-[(5-phenyl-1,3-oxazol-4-yl)methylidene]piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)NC(=Cc2ncoc2-c2ccccc2)C1=O |
| InChI | InChI=1S/C16H13N3O4/c1-10(20)19-8-14(21)18-13(16(19)22)7-12-15(23-9-17-12)11-5-3-2-4-6-11/h2-7,9H,8H2,1H3,(H,18,21) |
| InChIKey | LFPZRMGMHVKHSP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|