C20H18N4O6 — CID 14194855
(3Z)-1-acetyl-3-[[4-[(Z)-(4-acetyl-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methylidene]piperazine-2,5-dione (PubChem CID 14194855) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is (3Z)-1-acetyl-3-[[4-[(Z)-(4-acetyl-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methylidene]piperazine-2,5-dione.
| Compound Name | (3Z)-1-acetyl-3-[[4-[(Z)-(4-acetyl-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 14194855 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (3Z)-1-acetyl-3-[[4-[(Z)-(4-acetyl-3,6-dioxopiperazin-2-ylidene)methyl]phenyl]methylidene]piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)N/C(=C\c2ccc(/C=C3\NC(=O)CN(C(C)=O)C3=O)cc2)C1=O |
| InChI | InChI=1S/C20H18N4O6/c1-11(25)23-9-17(27)21-15(19(23)29)7-13-3-5-14(6-4-13)8-16-20(30)24(12(2)26)10-18(28)22-16/h3-8H,9-10H2,1-2H3,(H,21,27)(H,22,28)/b15-7-,16-8- |
| InChIKey | QZPZBYRXTOZXPE-DUGOVBPYSA-N |
| XLogP | -0.62 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|