C14H17N3O3S — CID 140873576
(3Z)-1-acetyl-3-[(5-tert-butyl-1,3-thiazol-4-yl)-deuteriomethylidene]piperazine-2,5-dione (PubChem CID 140873576) has the molecular formula C14H17N3O3S and a molecular weight of 308.38 g/mol. Its IUPAC name is (3Z)-1-acetyl-3-[(5-tert-butyl-1,3-thiazol-4-yl)-deuteriomethylidene]piperazine-2,5-dione.
| Compound Name | (3Z)-1-acetyl-3-[(5-tert-butyl-1,3-thiazol-4-yl)-deuteriomethylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 140873576 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (3Z)-1-acetyl-3-[(5-tert-butyl-1,3-thiazol-4-yl)-deuteriomethylidene]piperazine-2,5-dione |
| SMILES | [2H]/C(=C1/NC(=O)CN(C(C)=O)C1=O)c1ncsc1C(C)(C)C |
| InChI | InChI=1S/C14H17N3O3S/c1-8(18)17-6-11(19)16-10(13(17)20)5-9-12(14(2,3)4)21-7-15-9/h5,7H,6H2,1-4H3,(H,16,19)/b10-5-/i5D |
| InChIKey | WADYXHCCLCADTR-QDRVQTHMSA-N |
| XLogP | 1.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|