C11H6N2O6S2 — CID 175528457
2-(methylideneamino)-5-(5-nitrothiophen-2-yl)thiophene-3,4-dicarboxylic acid (PubChem CID 175528457) has the molecular formula C11H6N2O6S2 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-(methylideneamino)-5-(5-nitrothiophen-2-yl)thiophene-3,4-dicarboxylic acid.
| Compound Name | 2-(methylideneamino)-5-(5-nitrothiophen-2-yl)thiophene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 175528457 |
| Molecular Formula | C11H6N2O6S2 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 2-(methylideneamino)-5-(5-nitrothiophen-2-yl)thiophene-3,4-dicarboxylic acid |
| SMILES | C=Nc1sc(-c2ccc([N+](=O)[O-])s2)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C11H6N2O6S2/c1-12-9-7(11(16)17)6(10(14)15)8(21-9)4-2-3-5(20-4)13(18)19/h2-3H,1H2,(H,14,15)(H,16,17) |
| InChIKey | ICJOTBAZFSWJQJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|