C12H9F6NO5 — CID 175528501
(2,2,2-trifluoroacetyl) 3-[[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]oxy]propanoate (PubChem CID 175528501) has the molecular formula C12H9F6NO5 and a molecular weight of 361.19 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]oxy]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 175528501 |
| Molecular Formula | C12H9F6NO5 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]oxy]propanoate |
| SMILES | COc1ncc(OCCC(=O)OC(=O)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H9F6NO5/c1-22-9-7(11(13,14)15)4-6(5-19-9)23-3-2-8(20)24-10(21)12(16,17)18/h4-5H,2-3H2,1H3 |
| InChIKey | FJQUQNUYYAWSNC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|