C13H12ClF2N3O2 — CID 175530526
[2-(3-chlorophenyl)-1-[1-(difluoromethyl)pyrazol-3-yl]ethyl] carbamate (PubChem CID 175530526) has the molecular formula C13H12ClF2N3O2 and a molecular weight of 315.71 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-1-[1-(difluoromethyl)pyrazol-3-yl]ethyl] carbamate.
| Compound Name | [2-(3-chlorophenyl)-1-[1-(difluoromethyl)pyrazol-3-yl]ethyl] carbamate |
|---|---|
| PubChem CID | 175530526 |
| Molecular Formula | C13H12ClF2N3O2 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | [2-(3-chlorophenyl)-1-[1-(difluoromethyl)pyrazol-3-yl]ethyl] carbamate |
| SMILES | NC(=O)OC(Cc1cccc(Cl)c1)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C13H12ClF2N3O2/c14-9-3-1-2-8(6-9)7-11(21-13(17)20)10-4-5-19(18-10)12(15)16/h1-6,11-12H,7H2,(H2,17,20) |
| InChIKey | OGZAVCVWXHNIEV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |