C17H20ClF2N3O2 — CID 166164140
tert-butyl N-[(1S)-2-(3-chlorophenyl)-1-[1-(difluoromethyl)pyrazol-3-yl]ethyl]carbamate (PubChem CID 166164140) has the molecular formula C17H20ClF2N3O2 and a molecular weight of 371.82 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-(3-chlorophenyl)-1-[1-(difluoromethyl)pyrazol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-(3-chlorophenyl)-1-[1-(difluoromethyl)pyrazol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 166164140 |
| Molecular Formula | C17H20ClF2N3O2 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | tert-butyl N-[(1S)-2-(3-chlorophenyl)-1-[1-(difluoromethyl)pyrazol-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cccc(Cl)c1)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C17H20ClF2N3O2/c1-17(2,3)25-16(24)21-14(10-11-5-4-6-12(18)9-11)13-7-8-23(22-13)15(19)20/h4-9,14-15H,10H2,1-3H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | LGDPCMLXGRJYMC-AWEZNQCLSA-N |
| XLogP | 4.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |