C12H17BrO3S — CID 175532559
3-bromo-4-methyl-2-(3-methylbutyl)benzenesulfonic acid (PubChem CID 175532559) has the molecular formula C12H17BrO3S and a molecular weight of 321.24 g/mol. Its IUPAC name is 3-bromo-4-methyl-2-(3-methylbutyl)benzenesulfonic acid.
| Compound Name | 3-bromo-4-methyl-2-(3-methylbutyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 175532559 |
| Molecular Formula | C12H17BrO3S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 3-bromo-4-methyl-2-(3-methylbutyl)benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCC(C)C)c1Br |
| InChI | InChI=1S/C12H17BrO3S/c1-8(2)4-6-10-11(17(14,15)16)7-5-9(3)12(10)13/h5,7-8H,4,6H2,1-3H3,(H,14,15,16) |
| InChIKey | CNGZHINVRSJUKX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|