About 1,1'-biphenyl;2-bromopyridine
1,1'-biphenyl;2-bromopyridine (PubChem CID 175532742) has the molecular formula C17H14BrN
and a molecular weight of 312.21 g/mol. Its IUPAC name is 1,1'-biphenyl;2-bromopyridine.
Molecular Properties
| Compound Name | 1,1'-biphenyl;2-bromopyridine |
| PubChem CID | 175532742 |
| Molecular Formula | C17H14BrN |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 1,1'-biphenyl;2-bromopyridine |
| SMILES | Brc1ccccn1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C5H4BrN/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;6-5-3-1-2-4-7-5/h1-10H;1-4H |
| InChIKey | MFKMQGOZCASCST-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;2-bromopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;2-bromopyridine?
The IUPAC name of 1,1'-biphenyl;2-bromopyridine (CID 175532742) is 1,1'-biphenyl;2-bromopyridine.
What is the SMILES notation for 1,1'-biphenyl;2-bromopyridine?
The canonical SMILES for 1,1'-biphenyl;2-bromopyridine is Brc1ccccn1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;2-bromopyridine?
The InChIKey is MFKMQGOZCASCST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C5H4BrN/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;6-5-3-1-2-4-7-5/h1-10H;1-4H.
What are the key properties of 1,1'-biphenyl;2-bromopyridine?
1,1'-biphenyl;2-bromopyridine has a molecular weight of 312.21 g/mol, XLogP of 5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;2-bromopyridine is sourced from PubChem (CID 175532742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).