About 2-bromopyridine;N,N-diphenylaniline
2-bromopyridine;N,N-diphenylaniline (PubChem CID 175451382) has the molecular formula C23H19BrN2
and a molecular weight of 403.32 g/mol. Its IUPAC name is 2-bromopyridine;N,N-diphenylaniline.
Molecular Properties
| Compound Name | 2-bromopyridine;N,N-diphenylaniline |
| PubChem CID | 175451382 |
| Molecular Formula | C23H19BrN2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-bromopyridine;N,N-diphenylaniline |
| SMILES | Brc1ccccn1.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C5H4BrN/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-5-3-1-2-4-7-5/h1-15H;1-4H |
| InChIKey | JBWROLPIAKANBR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopyridine;N,N-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopyridine;N,N-diphenylaniline?
The IUPAC name of 2-bromopyridine;N,N-diphenylaniline (CID 175451382) is 2-bromopyridine;N,N-diphenylaniline.
What is the SMILES notation for 2-bromopyridine;N,N-diphenylaniline?
The canonical SMILES for 2-bromopyridine;N,N-diphenylaniline is Brc1ccccn1.c1ccc(N(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-bromopyridine;N,N-diphenylaniline?
The InChIKey is JBWROLPIAKANBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C5H4BrN/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-5-3-1-2-4-7-5/h1-15H;1-4H.
What are the key properties of 2-bromopyridine;N,N-diphenylaniline?
2-bromopyridine;N,N-diphenylaniline has a molecular weight of 403.32 g/mol, XLogP of 7.00, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopyridine;N,N-diphenylaniline is sourced from PubChem (CID 175451382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).