C21H24F3NO8S — CID 175533587
[(2R,3R,4R,6S)-3,4-diacetyloxy-5-(4-methylphenyl)-6-sulfanyl-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 175533587) has the molecular formula C21H24F3NO8S and a molecular weight of 507.48 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-3,4-diacetyloxy-5-(4-methylphenyl)-6-sulfanyl-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-5-(4-methylphenyl)-6-sulfanyl-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175533587 |
| Molecular Formula | C21H24F3NO8S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-5-(4-methylphenyl)-6-sulfanyl-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S)C(NC(=O)C(F)(F)F)(c2ccc(C)cc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H24F3NO8S/c1-10-5-7-14(8-6-10)20(25-18(29)21(22,23)24)17(32-13(4)28)16(31-12(3)27)15(33-19(20)34)9-30-11(2)26/h5-8,15-17,19,34H,9H2,1-4H3,(H,25,29)/t15-,16+,17+,19+,20?/m1/s1 |
| InChIKey | SYIDWRXYGBFURO-ILYXJISGSA-N |
| XLogP | 1.95 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|