C19H32O — CID 175534938
5-methyl-2-propan-2-yl-1,3,5-tris(prop-2-enyl)cyclohexan-1-ol (PubChem CID 175534938) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-1,3,5-tris(prop-2-enyl)cyclohexan-1-ol.
| Compound Name | 5-methyl-2-propan-2-yl-1,3,5-tris(prop-2-enyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 175534938 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 5-methyl-2-propan-2-yl-1,3,5-tris(prop-2-enyl)cyclohexan-1-ol |
| SMILES | C=CCC1CC(C)(CC=C)CC(O)(CC=C)C1C(C)C |
| InChI | InChI=1S/C19H32O/c1-7-10-16-13-18(6,11-8-2)14-19(20,12-9-3)17(16)15(4)5/h7-9,15-17,20H,1-3,10-14H2,4-6H3 |
| InChIKey | INKLUEMLNZJKJL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|