About fluorobenzene;2-fluoroethenoxy(trimethyl)silane
fluorobenzene;2-fluoroethenoxy(trimethyl)silane (PubChem CID 175535258) has the molecular formula C11H16F2OSi
and a molecular weight of 230.33 g/mol. Its IUPAC name is fluorobenzene;2-fluoroethenoxy(trimethyl)silane.
Molecular Properties
| Compound Name | fluorobenzene;2-fluoroethenoxy(trimethyl)silane |
| PubChem CID | 175535258 |
| Molecular Formula | C11H16F2OSi |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | fluorobenzene;2-fluoroethenoxy(trimethyl)silane |
| SMILES | C[Si](C)(C)OC=CF.Fc1ccccc1 |
| InChI | InChI=1S/C6H5F.C5H11FOSi/c7-6-4-2-1-3-5-6;1-8(2,3)7-5-4-6/h1-5H;4-5H,1-3H3 |
| InChIKey | BTVQZOBILULYSU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluorobenzene;2-fluoroethenoxy(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;2-fluoroethenoxy(trimethyl)silane?
The IUPAC name of fluorobenzene;2-fluoroethenoxy(trimethyl)silane (CID 175535258) is fluorobenzene;2-fluoroethenoxy(trimethyl)silane.
What is the SMILES notation for fluorobenzene;2-fluoroethenoxy(trimethyl)silane?
The canonical SMILES for fluorobenzene;2-fluoroethenoxy(trimethyl)silane is C[Si](C)(C)OC=CF.Fc1ccccc1.
What is the InChIKey of fluorobenzene;2-fluoroethenoxy(trimethyl)silane?
The InChIKey is BTVQZOBILULYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F.C5H11FOSi/c7-6-4-2-1-3-5-6;1-8(2,3)7-5-4-6/h1-5H;4-5H,1-3H3.
What are the key properties of fluorobenzene;2-fluoroethenoxy(trimethyl)silane?
fluorobenzene;2-fluoroethenoxy(trimethyl)silane has a molecular weight of 230.33 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;2-fluoroethenoxy(trimethyl)silane is sourced from PubChem (CID 175535258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).