C11H13NO3 — CID 175536029
(3,3-dimethyl-2H-1-benzofuran-6-yl) carbamate (PubChem CID 175536029) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (3,3-dimethyl-2H-1-benzofuran-6-yl) carbamate.
| Compound Name | (3,3-dimethyl-2H-1-benzofuran-6-yl) carbamate |
|---|---|
| PubChem CID | 175536029 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3,3-dimethyl-2H-1-benzofuran-6-yl) carbamate |
| SMILES | CC1(C)COc2cc(OC(N)=O)ccc21 |
| InChI | InChI=1S/C11H13NO3/c1-11(2)6-14-9-5-7(15-10(12)13)3-4-8(9)11/h3-5H,6H2,1-2H3,(H2,12,13) |
| InChIKey | DTTRVKZBLVVFKP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |