C30H29F3N4O6 — CID 175537980
5-[[2-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-1,3-benzoxazol-6-yl]amino]-2-(hydroxymethylidene)-3-oxo-5-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]pent-4-enoic acid (PubChem CID 175537980) has the molecular formula C30H29F3N4O6 and a molecular weight of 598.58 g/mol. Its IUPAC name is 5-[[2-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-1,3-benzoxazol-6-yl]amino]-2-(hydroxymethylidene)-3-oxo-5-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]pent-4-enoic acid.
| Compound Name | 5-[[2-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-1,3-benzoxazol-6-yl]amino]-2-(hydroxymethylidene)-3-oxo-5-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 175537980 |
| Molecular Formula | C30H29F3N4O6 |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 5-[[2-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-1,3-benzoxazol-6-yl]amino]-2-(hydroxymethylidene)-3-oxo-5-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]pent-4-enoic acid |
| SMILES | O=C(O)C(=CO)C(=O)C=C(Nc1ccc2nc(N3CC4COCC4C3)oc2c1)c1ccc(N2CCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H29F3N4O6/c31-30(32,33)22-9-17(3-6-25(22)36-7-1-2-8-36)24(11-26(39)21(14-38)28(40)41)34-20-4-5-23-27(10-20)43-29(35-23)37-12-18-15-42-16-19(18)13-37/h3-6,9-11,14,18-19,34,38H,1-2,7-8,12-13,15-16H2,(H,40,41) |
| InChIKey | FEMDURHXGMDLSK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|