C19H21F3N4O3 — CID 46969268
1,3-dimethyl-2,6-dioxo-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 46969268) has the molecular formula C19H21F3N4O3 and a molecular weight of 410.40 g/mol. Its IUPAC name is 1,3-dimethyl-2,6-dioxo-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 1,3-dimethyl-2,6-dioxo-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 46969268 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1,3-dimethyl-2,6-dioxo-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(N3CCCCC3)c(C(F)(F)F)c2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C19H21F3N4O3/c1-24-15(11-16(27)25(2)18(24)29)17(28)23-12-6-7-14(13(10-12)19(20,21)22)26-8-4-3-5-9-26/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,23,28) |
| InChIKey | MAQXCVXEJCUFCN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|