C18H22F3N5O — CID 46971969
2-methyl-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 46971969) has the molecular formula C18H22F3N5O and a molecular weight of 381.40 g/mol. Its IUPAC name is 2-methyl-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | 2-methyl-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 46971969 |
| Molecular Formula | C18H22F3N5O |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-methyl-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(Cn1cncn1)C(=O)Nc1ccc(N2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H22F3N5O/c1-13(10-26-12-22-11-23-26)17(27)24-14-5-6-16(15(9-14)18(19,20)21)25-7-3-2-4-8-25/h5-6,9,11-13H,2-4,7-8,10H2,1H3,(H,24,27) |
| InChIKey | FJLJQLUCAFGTTR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|