C15H21N5OS — CID 51592077
(2S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-2-methyl-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 51592077) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is (2S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-2-methyl-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | (2S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-2-methyl-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 51592077 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (2S)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-2-methyl-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | C[C@@H](Cn1cncn1)C(=O)Nc1nc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C15H21N5OS/c1-11(8-20-10-16-9-17-20)14(21)19-15-18-12-6-4-2-3-5-7-13(12)22-15/h9-11H,2-8H2,1H3,(H,18,19,21)/t11-/m0/s1 |
| InChIKey | WGDULZZZQXUEIC-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |