C17H17N3OS — CID 175538762
4-[1-hydroxy-2-(4-phenylanilino)ethyl]-1,3-dihydroimidazole-2-thione (PubChem CID 175538762) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-[1-hydroxy-2-(4-phenylanilino)ethyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[1-hydroxy-2-(4-phenylanilino)ethyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 175538762 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-[1-hydroxy-2-(4-phenylanilino)ethyl]-1,3-dihydroimidazole-2-thione |
| SMILES | OC(CNc1ccc(-c2ccccc2)cc1)c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C17H17N3OS/c21-16(15-10-19-17(22)20-15)11-18-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-10,16,18,21H,11H2,(H2,19,20,22) |
| InChIKey | MNIRWOWUROKNAZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|