About carbamothioylsulfanyl carbamodithioate;1-methylpiperazine
carbamothioylsulfanyl carbamodithioate;1-methylpiperazine (PubChem CID 175540702) has the molecular formula C7H16N4S4
and a molecular weight of 284.50 g/mol. Its IUPAC name is carbamothioylsulfanyl carbamodithioate;1-methylpiperazine.
Molecular Properties
| Compound Name | carbamothioylsulfanyl carbamodithioate;1-methylpiperazine |
| PubChem CID | 175540702 |
| Molecular Formula | C7H16N4S4 |
| Molecular Weight | 284.50 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | carbamothioylsulfanyl carbamodithioate;1-methylpiperazine |
| SMILES | CN1CCNCC1.NC(=S)SSC(N)=S |
| InChI | InChI=1S/C5H12N2.C2H4N2S4/c1-7-4-2-6-3-5-7;3-1(5)7-8-2(4)6/h6H,2-5H2,1H3;(H2,3,5)(H2,4,6) |
| InChIKey | JUQKCPAQWXUHQY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.50 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze carbamothioylsulfanyl carbamodithioate;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioylsulfanyl carbamodithioate;1-methylpiperazine?
The IUPAC name of carbamothioylsulfanyl carbamodithioate;1-methylpiperazine (CID 175540702) is carbamothioylsulfanyl carbamodithioate;1-methylpiperazine.
What is the SMILES notation for carbamothioylsulfanyl carbamodithioate;1-methylpiperazine?
The canonical SMILES for carbamothioylsulfanyl carbamodithioate;1-methylpiperazine is CN1CCNCC1.NC(=S)SSC(N)=S.
What is the InChIKey of carbamothioylsulfanyl carbamodithioate;1-methylpiperazine?
The InChIKey is JUQKCPAQWXUHQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.C2H4N2S4/c1-7-4-2-6-3-5-7;3-1(5)7-8-2(4)6/h6H,2-5H2,1H3;(H2,3,5)(H2,4,6).
What are the key properties of carbamothioylsulfanyl carbamodithioate;1-methylpiperazine?
carbamothioylsulfanyl carbamodithioate;1-methylpiperazine has a molecular weight of 284.50 g/mol, XLogP of 0.38, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioylsulfanyl carbamodithioate;1-methylpiperazine is sourced from PubChem (CID 175540702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).